| Name | 5,10,15,20-tetraphenylporphyrin |
| Synonyms | TETRAPHENYLPORFYRIN RARECHEM AS SA 0001 tetraphenylporphine TETRAPHENYLPORPHINE tetraphenylporfyrin rarechem as sa 0001 tetraphenylporphyrin TETRAPHENYLPORPHYRIN meso-tetraphenylporphyrin meso-tetraphenylporphyrine meso-Tetraphenylporphyrine TETRAPHENYLPORPHINE METAL FREE tetraphenylporphine metal free 5,10,15,20-tetraphenylporphyrin porphine, 5,10,15,20-tetraphenyl- Porphine, 5,10,15,20-tetraphenyl- 23h-porphine,5,10,15,20-tetraphenyl-21 5,10,15,20-tetraphenyl-21h,23h-prophine 5,10,15,20-TETRAPHENYL-21H,23H-PORPHYRIN 21h,23h-porphine, 5,10,15,20-tetraphenyl- alpha,beta,gamma,delta-tetraphenylporphine |
| CAS | 917-23-7 |
| EINECS | 213-025-9 |
| InChI | InChI=1/C44H30N4/c1-5-13-29(14-6-1)38-27-37-26-35-22-21-33(45-35)25-34-23-24-36(46-34)28-39-40(30-15-7-2-8-16-30)41(31-17-9-3-10-18-31)44(48-39)42(43(38)47-37)32-19-11-4-12-20-32/h1-28,45,48H/b33-25-,34-25-,35-26-,36-28-,37-26-,39-28-,43-42-,44-42- |
| InChIKey | YNHJECZULSZAQK-LWQDQPMZSA-N |
| Molecular Formula | C44H30N4 |
| Molar Mass | 614.74 |
| Density | 1.5288 (rough estimate) |
| Melting Point | 300 °C |
| Boling Point | 648.45°C (rough estimate) |
| Water Solubility | Insoluble in water. |
| Solubility | dichloromethane: soluble |
| Appearance | Glistening Crystalline Powder |
| Color | Blue to purple |
| BRN | 379542 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.7030 (estimate) |
| MDL | MFCD00011680 |
| Use | Ultra-high sensitive photometric copper reagent |
| In vitro study | Porphyrins are dyes and cofactors found inhemoglobinandcytochromesand are related tochlorophyllandvitamin B12.The research of natural porphyrins is complicated by their low symmetry and the presence of polar substituents. Tetraphenylporphyrin is symmetrically substituted and easily synthesized compared to natural porphyrins. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-10-23 |
| TSCA | Yes |
| HS Code | 29349990 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| biological activity | Tetraphenylporphyrin (TPP) is a structurally symmetrically substituted, porphyrin-Based Heterocyclic compound, it can be used as a building block for supramolecular synthesis. Structural derivatives of Tetraphenylporphyrin are useful in cancer research. |
| Use | ultra-high sensitive photometric copper reagent |